C10H14N4O2S — CID 54962974
2-oxo-2-piperazin-1-yl-N-(1,3-thiazol-2-ylmethyl)acetamide (PubChem CID 54962974) has the molecular formula C10H14N4O2S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-oxo-2-piperazin-1-yl-N-(1,3-thiazol-2-ylmethyl)acetamide.
| Compound Name | 2-oxo-2-piperazin-1-yl-N-(1,3-thiazol-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 54962974 |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-oxo-2-piperazin-1-yl-N-(1,3-thiazol-2-ylmethyl)acetamide |
| SMILES | O=C(NCc1nccs1)C(=O)N1CCNCC1 |
| InChI | InChI=1S/C10H14N4O2S/c15-9(13-7-8-12-3-6-17-8)10(16)14-4-1-11-2-5-14/h3,6,11H,1-2,4-5,7H2,(H,13,15) |
| InChIKey | OCCKMIMLNGKLIO-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|