About 4-(4-methyl-1,3-thiazol-2-yl)-N-(1,3-thiazol-2-yl)piperazine-1-carboxamide
4-(4-methyl-1,3-thiazol-2-yl)-N-(1,3-thiazol-2-yl)piperazine-1-carboxamide (PubChem CID 47193079) has the molecular formula C12H15N5OS2
and a molecular weight of 309.42 g/mol. Its IUPAC name is 4-(4-methyl-1,3-thiazol-2-yl)-N-(1,3-thiazol-2-yl)piperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-(4-methyl-1,3-thiazol-2-yl)-N-(1,3-thiazol-2-yl)piperazine-1-carboxamide |
| PubChem CID | 47193079 |
| Molecular Formula | C12H15N5OS2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 4-(4-methyl-1,3-thiazol-2-yl)-N-(1,3-thiazol-2-yl)piperazine-1-carboxamide |
| SMILES | Cc1csc(N2CCN(C(=O)Nc3nccs3)CC2)n1 |
| InChI | InChI=1S/C12H15N5OS2/c1-9-8-20-12(14-9)17-5-3-16(4-6-17)11(18)15-10-13-2-7-19-10/h2,7-8H,3-6H2,1H3,(H,13,15,18) |
| InChIKey | JQPXVGOWHMAKJT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(4-methyl-1,3-thiazol-2-yl)-N-(1,3-thiazol-2-yl)piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methyl-1,3-thiazol-2-yl)-N-(1,3-thiazol-2-yl)piperazine-1-carboxamide?
The IUPAC name of 4-(4-methyl-1,3-thiazol-2-yl)-N-(1,3-thiazol-2-yl)piperazine-1-carboxamide (CID 47193079) is 4-(4-methyl-1,3-thiazol-2-yl)-N-(1,3-thiazol-2-yl)piperazine-1-carboxamide.
What is the SMILES notation for 4-(4-methyl-1,3-thiazol-2-yl)-N-(1,3-thiazol-2-yl)piperazine-1-carboxamide?
The canonical SMILES for 4-(4-methyl-1,3-thiazol-2-yl)-N-(1,3-thiazol-2-yl)piperazine-1-carboxamide is Cc1csc(N2CCN(C(=O)Nc3nccs3)CC2)n1.
What is the InChIKey of 4-(4-methyl-1,3-thiazol-2-yl)-N-(1,3-thiazol-2-yl)piperazine-1-carboxamide?
The InChIKey is JQPXVGOWHMAKJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N5OS2/c1-9-8-20-12(14-9)17-5-3-16(4-6-17)11(18)15-10-13-2-7-19-10/h2,7-8H,3-6H2,1H3,(H,13,15,18).
What are the key properties of 4-(4-methyl-1,3-thiazol-2-yl)-N-(1,3-thiazol-2-yl)piperazine-1-carboxamide?
4-(4-methyl-1,3-thiazol-2-yl)-N-(1,3-thiazol-2-yl)piperazine-1-carboxamide has a molecular weight of 309.42 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methyl-1,3-thiazol-2-yl)-N-(1,3-thiazol-2-yl)piperazine-1-carboxamide is sourced from PubChem (CID 47193079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).