C12H15N5S — CID 31981427
4-methyl-2-(4-pyrimidin-2-ylpiperazin-1-yl)-1,3-thiazole (PubChem CID 31981427) has the molecular formula C12H15N5S and a molecular weight of 261.35 g/mol. Its IUPAC name is 4-methyl-2-(4-pyrimidin-2-ylpiperazin-1-yl)-1,3-thiazole.
| Compound Name | 4-methyl-2-(4-pyrimidin-2-ylpiperazin-1-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 31981427 |
| Molecular Formula | C12H15N5S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 4-methyl-2-(4-pyrimidin-2-ylpiperazin-1-yl)-1,3-thiazole |
| SMILES | Cc1csc(N2CCN(c3ncccn3)CC2)n1 |
| InChI | InChI=1S/C12H15N5S/c1-10-9-18-12(15-10)17-7-5-16(6-8-17)11-13-3-2-4-14-11/h2-4,9H,5-8H2,1H3 |
| InChIKey | JQPHRJAPQNXYKY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |