C14H17N5O2S — CID 133272187
4-methyl-2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]-1,3-thiazole (PubChem CID 133272187) has the molecular formula C14H17N5O2S and a molecular weight of 319.39 g/mol. Its IUPAC name is 4-methyl-2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]-1,3-thiazole.
| Compound Name | 4-methyl-2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 133272187 |
| Molecular Formula | C14H17N5O2S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 4-methyl-2-[4-(3-nitro-2-pyridinyl)-1,4-diazepan-1-yl]-1,3-thiazole |
| SMILES | Cc1csc(N2CCCN(c3ncccc3[N+](=O)[O-])CC2)n1 |
| InChI | InChI=1S/C14H17N5O2S/c1-11-10-22-14(16-11)18-7-3-6-17(8-9-18)13-12(19(20)21)4-2-5-15-13/h2,4-5,10H,3,6-9H2,1H3 |
| InChIKey | DVMAJSCCWWBLIP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|