C17H21N5O5S — CID 133272207
[2-methyl-4-[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]-3,5-dinitrophenyl]methanol (PubChem CID 133272207) has the molecular formula C17H21N5O5S and a molecular weight of 407.45 g/mol. Its IUPAC name is [2-methyl-4-[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]-3,5-dinitrophenyl]methanol.
| Compound Name | [2-methyl-4-[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]-3,5-dinitrophenyl]methanol |
|---|---|
| PubChem CID | 133272207 |
| Molecular Formula | C17H21N5O5S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | [2-methyl-4-[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]-3,5-dinitrophenyl]methanol |
| SMILES | Cc1csc(N2CCCN(c3c([N+](=O)[O-])cc(CO)c(C)c3[N+](=O)[O-])CC2)n1 |
| InChI | InChI=1S/C17H21N5O5S/c1-11-10-28-17(18-11)20-5-3-4-19(6-7-20)16-14(21(24)25)8-13(9-23)12(2)15(16)22(26)27/h8,10,23H,3-7,9H2,1-2H3 |
| InChIKey | OZJGCPYRSFWXPW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 125.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|