C17H21N5O5S — CID 133476616
[2-methyl-3,5-dinitro-4-[4-[1-(1,3-thiazol-2-yl)ethyl]piperazin-1-yl]phenyl]methanol (PubChem CID 133476616) has the molecular formula C17H21N5O5S and a molecular weight of 407.45 g/mol. Its IUPAC name is [2-methyl-3,5-dinitro-4-[4-[1-(1,3-thiazol-2-yl)ethyl]piperazin-1-yl]phenyl]methanol.
| Compound Name | [2-methyl-3,5-dinitro-4-[4-[1-(1,3-thiazol-2-yl)ethyl]piperazin-1-yl]phenyl]methanol |
|---|---|
| PubChem CID | 133476616 |
| Molecular Formula | C17H21N5O5S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | [2-methyl-3,5-dinitro-4-[4-[1-(1,3-thiazol-2-yl)ethyl]piperazin-1-yl]phenyl]methanol |
| SMILES | Cc1c(CO)cc([N+](=O)[O-])c(N2CCN(C(C)c3nccs3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H21N5O5S/c1-11-13(10-23)9-14(21(24)25)16(15(11)22(26)27)20-6-4-19(5-7-20)12(2)17-18-3-8-28-17/h3,8-9,12,23H,4-7,10H2,1-2H3 |
| InChIKey | QNUILMNSAZBOQB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 125.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|