C18H27N5O5 — CID 133315551
[2-methyl-4-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]-3,5-dinitrophenyl]methanol (PubChem CID 133315551) has the molecular formula C18H27N5O5 and a molecular weight of 393.44 g/mol. Its IUPAC name is [2-methyl-4-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]-3,5-dinitrophenyl]methanol.
| Compound Name | [2-methyl-4-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]-3,5-dinitrophenyl]methanol |
|---|---|
| PubChem CID | 133315551 |
| Molecular Formula | C18H27N5O5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | [2-methyl-4-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]-3,5-dinitrophenyl]methanol |
| SMILES | Cc1c(CO)cc([N+](=O)[O-])c(N2CCN(C3CCCN(C)C3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H27N5O5/c1-13-14(12-24)10-16(22(25)26)18(17(13)23(27)28)21-8-6-20(7-9-21)15-4-3-5-19(2)11-15/h10,15,24H,3-9,11-12H2,1-2H3 |
| InChIKey | FFJJSTPDHWOIGX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 116.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|