C18H25ClN4O4 — CID 133389042
methyl 2-chloro-4-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]-5-nitrobenzoate (PubChem CID 133389042) has the molecular formula C18H25ClN4O4 and a molecular weight of 396.88 g/mol. Its IUPAC name is methyl 2-chloro-4-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]-5-nitrobenzoate.
| Compound Name | methyl 2-chloro-4-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 133389042 |
| Molecular Formula | C18H25ClN4O4 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | methyl 2-chloro-4-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(N2CCN(C3CCCN(C)C3)CC2)cc1Cl |
| InChI | InChI=1S/C18H25ClN4O4/c1-20-5-3-4-13(12-20)21-6-8-22(9-7-21)16-11-15(19)14(18(24)27-2)10-17(16)23(25)26/h10-11,13H,3-9,12H2,1-2H3 |
| InChIKey | DGFPSFPLHQWVHF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 79.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|