C15H19ClN2O5 — CID 133388917
methyl 2-chloro-4-[3-(methoxymethyl)piperidin-1-yl]-5-nitrobenzoate (PubChem CID 133388917) has the molecular formula C15H19ClN2O5 and a molecular weight of 342.78 g/mol. Its IUPAC name is methyl 2-chloro-4-[3-(methoxymethyl)piperidin-1-yl]-5-nitrobenzoate.
| Compound Name | methyl 2-chloro-4-[3-(methoxymethyl)piperidin-1-yl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 133388917 |
| Molecular Formula | C15H19ClN2O5 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | methyl 2-chloro-4-[3-(methoxymethyl)piperidin-1-yl]-5-nitrobenzoate |
| SMILES | COCC1CCCN(c2cc(Cl)c(C(=O)OC)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H19ClN2O5/c1-22-9-10-4-3-5-17(8-10)13-7-12(16)11(15(19)23-2)6-14(13)18(20)21/h6-7,10H,3-5,8-9H2,1-2H3 |
| InChIKey | DDXOIQREGDOBSM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|