C17H16ClF3N4O4 — CID 133450812
methyl 2-chloro-5-nitro-4-[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]benzoate (PubChem CID 133450812) has the molecular formula C17H16ClF3N4O4 and a molecular weight of 432.79 g/mol. Its IUPAC name is methyl 2-chloro-5-nitro-4-[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]benzoate.
| Compound Name | methyl 2-chloro-5-nitro-4-[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]benzoate |
|---|---|
| PubChem CID | 133450812 |
| Molecular Formula | C17H16ClF3N4O4 |
| Molecular Weight | 432.79 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | methyl 2-chloro-5-nitro-4-[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]benzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(N2CCCC(n3ccc(C(F)(F)F)n3)C2)cc1Cl |
| InChI | InChI=1S/C17H16ClF3N4O4/c1-29-16(26)11-7-14(25(27)28)13(8-12(11)18)23-5-2-3-10(9-23)24-6-4-15(22-24)17(19,20)21/h4,6-8,10H,2-3,5,9H2,1H3 |
| InChIKey | HTKDFOPNJIQXDJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.79 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|