C16H16F4N4O3 — CID 133450947
1-(2-fluoro-5-methoxy-4-nitrophenyl)-3-[3-(trifluoromethyl)pyrazol-1-yl]piperidine (PubChem CID 133450947) has the molecular formula C16H16F4N4O3 and a molecular weight of 388.32 g/mol. Its IUPAC name is 1-(2-fluoro-5-methoxy-4-nitrophenyl)-3-[3-(trifluoromethyl)pyrazol-1-yl]piperidine.
| Compound Name | 1-(2-fluoro-5-methoxy-4-nitrophenyl)-3-[3-(trifluoromethyl)pyrazol-1-yl]piperidine |
|---|---|
| PubChem CID | 133450947 |
| Molecular Formula | C16H16F4N4O3 |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1-(2-fluoro-5-methoxy-4-nitrophenyl)-3-[3-(trifluoromethyl)pyrazol-1-yl]piperidine |
| SMILES | COc1cc(N2CCCC(n3ccc(C(F)(F)F)n3)C2)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16F4N4O3/c1-27-14-8-12(11(17)7-13(14)24(25)26)22-5-2-3-10(9-22)23-6-4-15(21-23)16(18,19)20/h4,6-8,10H,2-3,5,9H2,1H3 |
| InChIKey | CHEWMBPGDJUMJT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 73.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|