C15H14F3N7O2 — CID 133450922
3-nitro-6-[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]imidazo[1,2-b]pyridazine (PubChem CID 133450922) has the molecular formula C15H14F3N7O2 and a molecular weight of 381.32 g/mol. Its IUPAC name is 3-nitro-6-[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]imidazo[1,2-b]pyridazine.
| Compound Name | 3-nitro-6-[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 133450922 |
| Molecular Formula | C15H14F3N7O2 |
| Molecular Weight | 381.32 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 3-nitro-6-[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]imidazo[1,2-b]pyridazine |
| SMILES | O=[N+]([O-])c1cnc2ccc(N3CCCC(n4ccc(C(F)(F)F)n4)C3)nn12 |
| InChI | InChI=1S/C15H14F3N7O2/c16-15(17,18)11-5-7-23(20-11)10-2-1-6-22(9-10)13-4-3-12-19-8-14(25(26)27)24(12)21-13/h3-5,7-8,10H,1-2,6,9H2 |
| InChIKey | DQVXQUFHDBMHOJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|