C14H13BrF3N5O2 — CID 133450840
3-bromo-5-nitro-2-[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]pyridine (PubChem CID 133450840) has the molecular formula C14H13BrF3N5O2 and a molecular weight of 420.19 g/mol. Its IUPAC name is 3-bromo-5-nitro-2-[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]pyridine.
| Compound Name | 3-bromo-5-nitro-2-[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]pyridine |
|---|---|
| PubChem CID | 133450840 |
| Molecular Formula | C14H13BrF3N5O2 |
| Molecular Weight | 420.19 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | 3-bromo-5-nitro-2-[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]pyridine |
| SMILES | O=[N+]([O-])c1cnc(N2CCCC(n3ccc(C(F)(F)F)n3)C2)c(Br)c1 |
| InChI | InChI=1S/C14H13BrF3N5O2/c15-11-6-10(23(24)25)7-19-13(11)21-4-1-2-9(8-21)22-5-3-12(20-22)14(16,17)18/h3,5-7,9H,1-2,4,8H2 |
| InChIKey | OTSDWNABRFPYBJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 77.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.19 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|