C11H15BrN4O2 — CID 79535406
1-(3-bromo-5-nitro-2-pyridinyl)-3,5-dimethylpiperazine (PubChem CID 79535406) has the molecular formula C11H15BrN4O2 and a molecular weight of 315.17 g/mol. Its IUPAC name is 1-(3-bromo-5-nitro-2-pyridinyl)-3,5-dimethylpiperazine.
| Compound Name | 1-(3-bromo-5-nitro-2-pyridinyl)-3,5-dimethylpiperazine |
|---|---|
| PubChem CID | 79535406 |
| Molecular Formula | C11H15BrN4O2 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 1-(3-bromo-5-nitro-2-pyridinyl)-3,5-dimethylpiperazine |
| SMILES | CC1CN(c2ncc([N+](=O)[O-])cc2Br)CC(C)N1 |
| InChI | InChI=1S/C11H15BrN4O2/c1-7-5-15(6-8(2)14-7)11-10(12)3-9(4-13-11)16(17)18/h3-4,7-8,14H,5-6H2,1-2H3 |
| InChIKey | QWNMMIFBKOMIMU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|