C10H13N3O4 — CID 106673378
1-(3-methyl-5-nitro-2-pyridinyl)pyrrolidine-3,4-diol (PubChem CID 106673378) has the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. Its IUPAC name is 1-(3-methyl-5-nitro-2-pyridinyl)pyrrolidine-3,4-diol.
| Compound Name | 1-(3-methyl-5-nitro-2-pyridinyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106673378 |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 1-(3-methyl-5-nitro-2-pyridinyl)pyrrolidine-3,4-diol |
| SMILES | Cc1cc([N+](=O)[O-])cnc1N1CC(O)C(O)C1 |
| InChI | InChI=1S/C10H13N3O4/c1-6-2-7(13(16)17)3-11-10(6)12-4-8(14)9(15)5-12/h2-3,8-9,14-15H,4-5H2,1H3 |
| InChIKey | LJOIPVMVJYFCTE-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 99.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|