C11H14BrN3O3S — CID 99107216
(1R,2S,3R)-4-(3-bromo-5-nitro-2-pyridinyl)-2,3-dimethyl-1,4-thiazinane 1-oxide (PubChem CID 99107216) has the molecular formula C11H14BrN3O3S and a molecular weight of 348.22 g/mol. Its IUPAC name is (1R,2S,3R)-4-(3-bromo-5-nitro-2-pyridinyl)-2,3-dimethyl-1,4-thiazinane 1-oxide.
| Compound Name | (1R,2S,3R)-4-(3-bromo-5-nitro-2-pyridinyl)-2,3-dimethyl-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 99107216 |
| Molecular Formula | C11H14BrN3O3S |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | (1R,2S,3R)-4-(3-bromo-5-nitro-2-pyridinyl)-2,3-dimethyl-1,4-thiazinane 1-oxide |
| SMILES | C[C@@H]1[C@H](C)[S@](=O)CCN1c1ncc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C11H14BrN3O3S/c1-7-8(2)19(18)4-3-14(7)11-10(12)5-9(6-13-11)15(16)17/h5-8H,3-4H2,1-2H3/t7-,8+,19-/m1/s1 |
| InChIKey | YPXPHIZKTYCYIU-MMVHXTGXSA-N |
| XLogP | 2.10 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|