C10H9BrN4O2 — CID 79523372
3-bromo-2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine (PubChem CID 79523372) has the molecular formula C10H9BrN4O2 and a molecular weight of 297.11 g/mol. Its IUPAC name is 3-bromo-2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine.
| Compound Name | 3-bromo-2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine |
|---|---|
| PubChem CID | 79523372 |
| Molecular Formula | C10H9BrN4O2 |
| Molecular Weight | 297.11 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | 3-bromo-2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine |
| SMILES | Cc1cc(C)n(-c2ncc([N+](=O)[O-])cc2Br)n1 |
| InChI | InChI=1S/C10H9BrN4O2/c1-6-3-7(2)14(13-6)10-9(11)4-8(5-12-10)15(16)17/h3-5H,1-2H3 |
| InChIKey | NYHYEHWTPYYIFW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.11 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|