C18H17N7O2 — CID 1249564
2,3-bis(3,5-dimethylpyrazol-1-yl)-6-nitroquinoxaline (PubChem CID 1249564) has the molecular formula C18H17N7O2 and a molecular weight of 363.38 g/mol. Its IUPAC name is 2,3-bis(3,5-dimethylpyrazol-1-yl)-6-nitroquinoxaline.
| Compound Name | 2,3-bis(3,5-dimethylpyrazol-1-yl)-6-nitroquinoxaline |
|---|---|
| PubChem CID | 1249564 |
| Molecular Formula | C18H17N7O2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 2,3-bis(3,5-dimethylpyrazol-1-yl)-6-nitroquinoxaline |
| SMILES | Cc1cc(C)n(-c2nc3ccc([N+](=O)[O-])cc3nc2-n2nc(C)cc2C)n1 |
| InChI | InChI=1S/C18H17N7O2/c1-10-7-12(3)23(21-10)17-18(24-13(4)8-11(2)22-24)20-16-9-14(25(26)27)5-6-15(16)19-17/h5-9H,1-4H3 |
| InChIKey | PKIYOVGRMXGCGW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 104.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|