C18H23N5O2 — CID 4597717
6-nitro-2,3-di(piperidin-1-yl)quinoxaline (PubChem CID 4597717) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 6-nitro-2,3-di(piperidin-1-yl)quinoxaline.
| Compound Name | 6-nitro-2,3-di(piperidin-1-yl)quinoxaline |
|---|---|
| PubChem CID | 4597717 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 6-nitro-2,3-di(piperidin-1-yl)quinoxaline |
| SMILES | O=[N+]([O-])c1ccc2nc(N3CCCCC3)c(N3CCCCC3)nc2c1 |
| InChI | InChI=1S/C18H23N5O2/c24-23(25)14-7-8-15-16(13-14)20-18(22-11-5-2-6-12-22)17(19-15)21-9-3-1-4-10-21/h7-8,13H,1-6,9-12H2 |
| InChIKey | UFJSUCGVLKZJDD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|