C17H24N6O3 — CID 133421452
3-nitro-6-[3-(2-piperidin-1-ylethoxy)pyrrolidin-1-yl]imidazo[1,2-b]pyridazine (PubChem CID 133421452) has the molecular formula C17H24N6O3 and a molecular weight of 360.42 g/mol. Its IUPAC name is 3-nitro-6-[3-(2-piperidin-1-ylethoxy)pyrrolidin-1-yl]imidazo[1,2-b]pyridazine.
| Compound Name | 3-nitro-6-[3-(2-piperidin-1-ylethoxy)pyrrolidin-1-yl]imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 133421452 |
| Molecular Formula | C17H24N6O3 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 3-nitro-6-[3-(2-piperidin-1-ylethoxy)pyrrolidin-1-yl]imidazo[1,2-b]pyridazine |
| SMILES | O=[N+]([O-])c1cnc2ccc(N3CCC(OCCN4CCCCC4)C3)nn12 |
| InChI | InChI=1S/C17H24N6O3/c24-23(25)17-12-18-15-4-5-16(19-22(15)17)21-9-6-14(13-21)26-11-10-20-7-2-1-3-8-20/h4-5,12,14H,1-3,6-11,13H2 |
| InChIKey | OQSQVHAWJJGUKA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|