C17H23N7O3 — CID 133419569
2-[4-(3-nitroimidazo[1,2-b]pyridazin-6-yl)piperazin-1-yl]-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 133419569) has the molecular formula C17H23N7O3 and a molecular weight of 373.42 g/mol. Its IUPAC name is 2-[4-(3-nitroimidazo[1,2-b]pyridazin-6-yl)piperazin-1-yl]-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 2-[4-(3-nitroimidazo[1,2-b]pyridazin-6-yl)piperazin-1-yl]-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 133419569 |
| Molecular Formula | C17H23N7O3 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2-[4-(3-nitroimidazo[1,2-b]pyridazin-6-yl)piperazin-1-yl]-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | CC(C(=O)N1CCCC1)N1CCN(c2ccc3ncc([N+](=O)[O-])n3n2)CC1 |
| InChI | InChI=1S/C17H23N7O3/c1-13(17(25)22-6-2-3-7-22)20-8-10-21(11-9-20)15-5-4-14-18-12-16(24(26)27)23(14)19-15/h4-5,12-13H,2-3,6-11H2,1H3 |
| InChIKey | OXWYWXKPGWNKMW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 100.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|