C17H17FN6O2 — CID 133420977
6-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]-3-nitroimidazo[1,2-b]pyridazine (PubChem CID 133420977) has the molecular formula C17H17FN6O2 and a molecular weight of 356.36 g/mol. Its IUPAC name is 6-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]-3-nitroimidazo[1,2-b]pyridazine.
| Compound Name | 6-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]-3-nitroimidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 133420977 |
| Molecular Formula | C17H17FN6O2 |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 6-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]-3-nitroimidazo[1,2-b]pyridazine |
| SMILES | O=[N+]([O-])c1cnc2ccc(N3CCN(Cc4cccc(F)c4)CC3)nn12 |
| InChI | InChI=1S/C17H17FN6O2/c18-14-3-1-2-13(10-14)12-21-6-8-22(9-7-21)16-5-4-15-19-11-17(24(25)26)23(15)20-16/h1-5,10-11H,6-9,12H2 |
| InChIKey | FOADHIQHTQYWEE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|