C15H11F2N5O2 — CID 133421030
5,7-difluoro-2-(3-nitroimidazo[1,2-b]pyridazin-6-yl)-3,4-dihydro-1H-isoquinoline (PubChem CID 133421030) has the molecular formula C15H11F2N5O2 and a molecular weight of 331.28 g/mol. Its IUPAC name is 5,7-difluoro-2-(3-nitroimidazo[1,2-b]pyridazin-6-yl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 5,7-difluoro-2-(3-nitroimidazo[1,2-b]pyridazin-6-yl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 133421030 |
| Molecular Formula | C15H11F2N5O2 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 5,7-difluoro-2-(3-nitroimidazo[1,2-b]pyridazin-6-yl)-3,4-dihydro-1H-isoquinoline |
| SMILES | O=[N+]([O-])c1cnc2ccc(N3CCc4c(F)cc(F)cc4C3)nn12 |
| InChI | InChI=1S/C15H11F2N5O2/c16-10-5-9-8-20(4-3-11(9)12(17)6-10)14-2-1-13-18-7-15(22(23)24)21(13)19-14/h1-2,5-7H,3-4,8H2 |
| InChIKey | BODLUSBSLBUWPI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|