C16H17N7O2 — CID 133433331
3-nitro-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]imidazo[1,2-b]pyridazin-6-amine (PubChem CID 133433331) has the molecular formula C16H17N7O2 and a molecular weight of 339.36 g/mol. Its IUPAC name is 3-nitro-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]imidazo[1,2-b]pyridazin-6-amine.
| Compound Name | 3-nitro-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]imidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133433331 |
| Molecular Formula | C16H17N7O2 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 3-nitro-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]imidazo[1,2-b]pyridazin-6-amine |
| SMILES | O=[N+]([O-])c1cnc2ccc(NCc3ccnc(N4CCCC4)c3)nn12 |
| InChI | InChI=1S/C16H17N7O2/c24-23(25)16-11-19-14-4-3-13(20-22(14)16)18-10-12-5-6-17-15(9-12)21-7-1-2-8-21/h3-6,9,11H,1-2,7-8,10H2,(H,18,20) |
| InChIKey | WXMHKLOHDZCLSV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|