C14H17F3N6O2 — CID 133486938
3-nitro-N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]imidazo[1,2-b]pyridazin-6-amine (PubChem CID 133486938) has the molecular formula C14H17F3N6O2 and a molecular weight of 358.32 g/mol. Its IUPAC name is 3-nitro-N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]imidazo[1,2-b]pyridazin-6-amine.
| Compound Name | 3-nitro-N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]imidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133486938 |
| Molecular Formula | C14H17F3N6O2 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 3-nitro-N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]imidazo[1,2-b]pyridazin-6-amine |
| SMILES | O=[N+]([O-])c1cnc2ccc(NCC3CCN(CC(F)(F)F)CC3)nn12 |
| InChI | InChI=1S/C14H17F3N6O2/c15-14(16,17)9-21-5-3-10(4-6-21)7-18-11-1-2-12-19-8-13(23(24)25)22(12)20-11/h1-2,8,10H,3-7,9H2,(H,18,20) |
| InChIKey | QQWPFXAVKXHBIN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|