C14H17F3N4O4 — CID 133486810
2,4-dinitro-N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]aniline (PubChem CID 133486810) has the molecular formula C14H17F3N4O4 and a molecular weight of 362.31 g/mol. Its IUPAC name is 2,4-dinitro-N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]aniline.
| Compound Name | 2,4-dinitro-N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]aniline |
|---|---|
| PubChem CID | 133486810 |
| Molecular Formula | C14H17F3N4O4 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 2,4-dinitro-N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]aniline |
| SMILES | O=[N+]([O-])c1ccc(NCC2CCN(CC(F)(F)F)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H17F3N4O4/c15-14(16,17)9-19-5-3-10(4-6-19)8-18-12-2-1-11(20(22)23)7-13(12)21(24)25/h1-2,7,10,18H,3-6,8-9H2 |
| InChIKey | OIADHYPPUCNPDL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|