C15H17F3N4O2 — CID 97223248
4-methyl-3-nitro-5-[[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]benzonitrile (PubChem CID 97223248) has the molecular formula C15H17F3N4O2 and a molecular weight of 342.32 g/mol. Its IUPAC name is 4-methyl-3-nitro-5-[[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]benzonitrile.
| Compound Name | 4-methyl-3-nitro-5-[[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]benzonitrile |
|---|---|
| PubChem CID | 97223248 |
| Molecular Formula | C15H17F3N4O2 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 4-methyl-3-nitro-5-[[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]benzonitrile |
| SMILES | Cc1c(NC[C@@H]2CCN(CC(F)(F)F)C2)cc(C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17F3N4O2/c1-10-13(4-12(6-19)5-14(10)22(23)24)20-7-11-2-3-21(8-11)9-15(16,17)18/h4-5,11,20H,2-3,7-9H2,1H3/t11-/m0/s1 |
| InChIKey | WEZPVUWGHYTETH-NSHDSACASA-N |
| XLogP | 3.07 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|