C17H17ClF3N5O3 — CID 133371476
4-chloro-2-(4-nitrophenyl)-5-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]pyridazin-3-one (PubChem CID 133371476) has the molecular formula C17H17ClF3N5O3 and a molecular weight of 431.80 g/mol. Its IUPAC name is 4-chloro-2-(4-nitrophenyl)-5-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]pyridazin-3-one.
| Compound Name | 4-chloro-2-(4-nitrophenyl)-5-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 133371476 |
| Molecular Formula | C17H17ClF3N5O3 |
| Molecular Weight | 431.80 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 4-chloro-2-(4-nitrophenyl)-5-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(NCC2CCN(CC(F)(F)F)C2)cnn1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H17ClF3N5O3/c18-15-14(22-7-11-5-6-24(9-11)10-17(19,20)21)8-23-25(16(15)27)12-1-3-13(4-2-12)26(28)29/h1-4,8,11,22H,5-7,9-10H2 |
| InChIKey | ZNWUOGBFFRBKIX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.80 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|