C16H15ClN6O3 — CID 133405612
4-chloro-5-[(1,5-dimethylpyrazol-4-yl)methylamino]-2-(4-nitrophenyl)pyridazin-3-one (PubChem CID 133405612) has the molecular formula C16H15ClN6O3 and a molecular weight of 374.79 g/mol. Its IUPAC name is 4-chloro-5-[(1,5-dimethylpyrazol-4-yl)methylamino]-2-(4-nitrophenyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[(1,5-dimethylpyrazol-4-yl)methylamino]-2-(4-nitrophenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 133405612 |
| Molecular Formula | C16H15ClN6O3 |
| Molecular Weight | 374.79 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 4-chloro-5-[(1,5-dimethylpyrazol-4-yl)methylamino]-2-(4-nitrophenyl)pyridazin-3-one |
| SMILES | Cc1c(CNc2cnn(-c3ccc([N+](=O)[O-])cc3)c(=O)c2Cl)cnn1C |
| InChI | InChI=1S/C16H15ClN6O3/c1-10-11(8-19-21(10)2)7-18-14-9-20-22(16(24)15(14)17)12-3-5-13(6-4-12)23(25)26/h3-6,8-9,18H,7H2,1-2H3 |
| InChIKey | CUQQROLVWKJRCF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.79 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|