C21H19ClN4O4 — CID 133308771
4-chloro-5-[(2-cyclobutyloxyphenyl)methylamino]-2-(4-nitrophenyl)pyridazin-3-one (PubChem CID 133308771) has the molecular formula C21H19ClN4O4 and a molecular weight of 426.86 g/mol. Its IUPAC name is 4-chloro-5-[(2-cyclobutyloxyphenyl)methylamino]-2-(4-nitrophenyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[(2-cyclobutyloxyphenyl)methylamino]-2-(4-nitrophenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 133308771 |
| Molecular Formula | C21H19ClN4O4 |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 4-chloro-5-[(2-cyclobutyloxyphenyl)methylamino]-2-(4-nitrophenyl)pyridazin-3-one |
| SMILES | O=c1c(Cl)c(NCc2ccccc2OC2CCC2)cnn1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H19ClN4O4/c22-20-18(23-12-14-4-1-2-7-19(14)30-17-5-3-6-17)13-24-25(21(20)27)15-8-10-16(11-9-15)26(28)29/h1-2,4,7-11,13,17,23H,3,5-6,12H2 |
| InChIKey | HSPIZIHAUZOUCI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|