C18H13ClF2N4O4 — CID 133291698
4-chloro-5-[2-(2,4-difluorophenoxy)ethylamino]-2-(4-nitrophenyl)pyridazin-3-one (PubChem CID 133291698) has the molecular formula C18H13ClF2N4O4 and a molecular weight of 422.78 g/mol. Its IUPAC name is 4-chloro-5-[2-(2,4-difluorophenoxy)ethylamino]-2-(4-nitrophenyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[2-(2,4-difluorophenoxy)ethylamino]-2-(4-nitrophenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 133291698 |
| Molecular Formula | C18H13ClF2N4O4 |
| Molecular Weight | 422.78 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 4-chloro-5-[2-(2,4-difluorophenoxy)ethylamino]-2-(4-nitrophenyl)pyridazin-3-one |
| SMILES | O=c1c(Cl)c(NCCOc2ccc(F)cc2F)cnn1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H13ClF2N4O4/c19-17-15(22-7-8-29-16-6-1-11(20)9-14(16)21)10-23-24(18(17)26)12-2-4-13(5-3-12)25(27)28/h1-6,9-10,22H,7-8H2 |
| InChIKey | RIBHQBUJFYXCAV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.78 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|