C20H17ClN6O3 — CID 133359324
5-[3-(1H-benzimidazol-2-yl)propylamino]-4-chloro-2-(4-nitrophenyl)pyridazin-3-one (PubChem CID 133359324) has the molecular formula C20H17ClN6O3 and a molecular weight of 424.85 g/mol. Its IUPAC name is 5-[3-(1H-benzimidazol-2-yl)propylamino]-4-chloro-2-(4-nitrophenyl)pyridazin-3-one.
| Compound Name | 5-[3-(1H-benzimidazol-2-yl)propylamino]-4-chloro-2-(4-nitrophenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 133359324 |
| Molecular Formula | C20H17ClN6O3 |
| Molecular Weight | 424.85 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 5-[3-(1H-benzimidazol-2-yl)propylamino]-4-chloro-2-(4-nitrophenyl)pyridazin-3-one |
| SMILES | O=c1c(Cl)c(NCCCc2nc3ccccc3[nH]2)cnn1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H17ClN6O3/c21-19-17(22-11-3-6-18-24-15-4-1-2-5-16(15)25-18)12-23-26(20(19)28)13-7-9-14(10-8-13)27(29)30/h1-2,4-5,7-10,12,22H,3,6,11H2,(H,24,25) |
| InChIKey | DKDLKZUPPANFBU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.85 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|