C16H13N5O2 — CID 51429599
2-[2-(1H-benzimidazol-2-yl)ethylamino]-5-nitrobenzonitrile (PubChem CID 51429599) has the molecular formula C16H13N5O2 and a molecular weight of 307.31 g/mol. Its IUPAC name is 2-[2-(1H-benzimidazol-2-yl)ethylamino]-5-nitrobenzonitrile.
| Compound Name | 2-[2-(1H-benzimidazol-2-yl)ethylamino]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 51429599 |
| Molecular Formula | C16H13N5O2 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2-[2-(1H-benzimidazol-2-yl)ethylamino]-5-nitrobenzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H13N5O2/c17-10-11-9-12(21(22)23)5-6-13(11)18-8-7-16-19-14-3-1-2-4-15(14)20-16/h1-6,9,18H,7-8H2,(H,19,20) |
| InChIKey | FNWPQNKBJSGRKU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 107.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|