C14H15N5O3 — CID 133295642
5-nitro-2-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylamino]benzonitrile (PubChem CID 133295642) has the molecular formula C14H15N5O3 and a molecular weight of 301.31 g/mol. Its IUPAC name is 5-nitro-2-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylamino]benzonitrile.
| Compound Name | 5-nitro-2-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 133295642 |
| Molecular Formula | C14H15N5O3 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 5-nitro-2-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylamino]benzonitrile |
| SMILES | CC(C)c1noc(CCNc2ccc([N+](=O)[O-])cc2C#N)n1 |
| InChI | InChI=1S/C14H15N5O3/c1-9(2)14-17-13(22-18-14)5-6-16-12-4-3-11(19(20)21)7-10(12)8-15/h3-4,7,9,16H,5-6H2,1-2H3 |
| InChIKey | YPDGDIHZTBLIHH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 117.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|