C13H17N3O2 — CID 47184868
2-(3,3-dimethylbutylamino)-5-nitrobenzonitrile (PubChem CID 47184868) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-(3,3-dimethylbutylamino)-5-nitrobenzonitrile.
| Compound Name | 2-(3,3-dimethylbutylamino)-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 47184868 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 2-(3,3-dimethylbutylamino)-5-nitrobenzonitrile |
| SMILES | CC(C)(C)CCNc1ccc([N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C13H17N3O2/c1-13(2,3)6-7-15-12-5-4-11(16(17)18)8-10(12)9-14/h4-5,8,15H,6-7H2,1-3H3 |
| InChIKey | WWGBRPCXSDHTON-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|