C10H8F3N3O2 — CID 63226791
5-nitro-2-(3,3,3-trifluoropropylamino)benzonitrile (PubChem CID 63226791) has the molecular formula C10H8F3N3O2 and a molecular weight of 259.19 g/mol. Its IUPAC name is 5-nitro-2-(3,3,3-trifluoropropylamino)benzonitrile.
| Compound Name | 5-nitro-2-(3,3,3-trifluoropropylamino)benzonitrile |
|---|---|
| PubChem CID | 63226791 |
| Molecular Formula | C10H8F3N3O2 |
| Molecular Weight | 259.19 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 5-nitro-2-(3,3,3-trifluoropropylamino)benzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NCCC(F)(F)F |
| InChI | InChI=1S/C10H8F3N3O2/c11-10(12,13)3-4-15-9-2-1-8(16(17)18)5-7(9)6-14/h1-2,5,15H,3-4H2 |
| InChIKey | JKLFXYPCSUKXGY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.19 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|