C10H11F3N2O2 — CID 63227359
2-methyl-5-nitro-N-(3,3,3-trifluoropropyl)aniline (PubChem CID 63227359) has the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. Its IUPAC name is 2-methyl-5-nitro-N-(3,3,3-trifluoropropyl)aniline.
| Compound Name | 2-methyl-5-nitro-N-(3,3,3-trifluoropropyl)aniline |
|---|---|
| PubChem CID | 63227359 |
| Molecular Formula | C10H11F3N2O2 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 2-methyl-5-nitro-N-(3,3,3-trifluoropropyl)aniline |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NCCC(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O2/c1-7-2-3-8(15(16)17)6-9(7)14-5-4-10(11,12)13/h2-3,6,14H,4-5H2,1H3 |
| InChIKey | ZMIPERXURBCIKF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|