About actinium;2-(2-methyl-5-nitroanilino)ethylazanide
actinium;2-(2-methyl-5-nitroanilino)ethylazanide (PubChem CID 21364796) has the molecular formula C9H12AcN3O2-
and a molecular weight of 421.21 g/mol. Its IUPAC name is actinium;2-(2-methyl-5-nitroanilino)ethylazanide.
Molecular Properties
| Compound Name | actinium;2-(2-methyl-5-nitroanilino)ethylazanide |
| PubChem CID | 21364796 |
| Molecular Formula | C9H12AcN3O2- |
| Molecular Weight | 421.21 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | actinium;2-(2-methyl-5-nitroanilino)ethylazanide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NCC[NH-].[Ac] |
| InChI | InChI=1S/C9H12N3O2.Ac/c1-7-2-3-8(12(13)14)6-9(7)11-5-4-10;/h2-3,6,10-11H,4-5H2,1H3;/q-1; |
| InChIKey | UYQWOFPMHMEFBE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze actinium;2-(2-methyl-5-nitroanilino)ethylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;2-(2-methyl-5-nitroanilino)ethylazanide?
The IUPAC name of actinium;2-(2-methyl-5-nitroanilino)ethylazanide (CID 21364796) is actinium;2-(2-methyl-5-nitroanilino)ethylazanide.
What is the SMILES notation for actinium;2-(2-methyl-5-nitroanilino)ethylazanide?
The canonical SMILES for actinium;2-(2-methyl-5-nitroanilino)ethylazanide is Cc1ccc([N+](=O)[O-])cc1NCC[NH-].[Ac].
What is the InChIKey of actinium;2-(2-methyl-5-nitroanilino)ethylazanide?
The InChIKey is UYQWOFPMHMEFBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N3O2.Ac/c1-7-2-3-8(12(13)14)6-9(7)11-5-4-10;/h2-3,6,10-11H,4-5H2,1H3;/q-1;.
What are the key properties of actinium;2-(2-methyl-5-nitroanilino)ethylazanide?
actinium;2-(2-methyl-5-nitroanilino)ethylazanide has a molecular weight of 421.21 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;2-(2-methyl-5-nitroanilino)ethylazanide is sourced from PubChem (CID 21364796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).