C16H12F3N3O3 — CID 24623955
5-nitro-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methylamino]benzonitrile (PubChem CID 24623955) has the molecular formula C16H12F3N3O3 and a molecular weight of 351.28 g/mol. Its IUPAC name is 5-nitro-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methylamino]benzonitrile.
| Compound Name | 5-nitro-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methylamino]benzonitrile |
|---|---|
| PubChem CID | 24623955 |
| Molecular Formula | C16H12F3N3O3 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 5-nitro-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methylamino]benzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NCc1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12F3N3O3/c17-16(18,19)10-25-14-4-1-11(2-5-14)9-21-15-6-3-13(22(23)24)7-12(15)8-20/h1-7,21H,9-10H2 |
| InChIKey | NEHLFXLABLVVMW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|