C14H9Cl2N3O2 — CID 43742415
2-[(3,4-dichlorophenyl)methylamino]-5-nitrobenzonitrile (PubChem CID 43742415) has the molecular formula C14H9Cl2N3O2 and a molecular weight of 322.15 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylamino]-5-nitrobenzonitrile.
| Compound Name | 2-[(3,4-dichlorophenyl)methylamino]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 43742415 |
| Molecular Formula | C14H9Cl2N3O2 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylamino]-5-nitrobenzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H9Cl2N3O2/c15-12-3-1-9(5-13(12)16)8-18-14-4-2-11(19(20)21)6-10(14)7-17/h1-6,18H,8H2 |
| InChIKey | YLZIPQLANBMOHH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|