C15H11F3N4O3 — CID 60502925
5-nitro-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methylamino]benzonitrile (PubChem CID 60502925) has the molecular formula C15H11F3N4O3 and a molecular weight of 352.27 g/mol. Its IUPAC name is 5-nitro-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methylamino]benzonitrile.
| Compound Name | 5-nitro-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methylamino]benzonitrile |
|---|---|
| PubChem CID | 60502925 |
| Molecular Formula | C15H11F3N4O3 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 5-nitro-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methylamino]benzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NCc1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C15H11F3N4O3/c16-15(17,18)9-25-14-4-1-10(8-21-14)7-20-13-3-2-12(22(23)24)5-11(13)6-19/h1-5,8,20H,7,9H2 |
| InChIKey | PQBHANLXUFSOLD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|