C9H10N4O4S — CID 43552415
2-(2-cyano-4-nitroanilino)ethanesulfonamide (PubChem CID 43552415) has the molecular formula C9H10N4O4S and a molecular weight of 270.27 g/mol. Its IUPAC name is 2-(2-cyano-4-nitroanilino)ethanesulfonamide.
| Compound Name | 2-(2-cyano-4-nitroanilino)ethanesulfonamide |
|---|---|
| PubChem CID | 43552415 |
| Molecular Formula | C9H10N4O4S |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 2-(2-cyano-4-nitroanilino)ethanesulfonamide |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NCCS(N)(=O)=O |
| InChI | InChI=1S/C9H10N4O4S/c10-6-7-5-8(13(14)15)1-2-9(7)12-3-4-18(11,16)17/h1-2,5,12H,3-4H2,(H2,11,16,17) |
| InChIKey | XLGOYQXOCHJSNY-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|