C9H11F2N3O4S — CID 63748992
2-[2-(difluoromethyl)-4-nitroanilino]ethanesulfonamide (PubChem CID 63748992) has the molecular formula C9H11F2N3O4S and a molecular weight of 295.27 g/mol. Its IUPAC name is 2-[2-(difluoromethyl)-4-nitroanilino]ethanesulfonamide.
| Compound Name | 2-[2-(difluoromethyl)-4-nitroanilino]ethanesulfonamide |
|---|---|
| PubChem CID | 63748992 |
| Molecular Formula | C9H11F2N3O4S |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 2-[2-(difluoromethyl)-4-nitroanilino]ethanesulfonamide |
| SMILES | NS(=O)(=O)CCNc1ccc([N+](=O)[O-])cc1C(F)F |
| InChI | InChI=1S/C9H11F2N3O4S/c10-9(11)7-5-6(14(15)16)1-2-8(7)13-3-4-19(12,17)18/h1-2,5,9,13H,3-4H2,(H2,12,17,18) |
| InChIKey | USBWVDKGNPBBCH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|