C12H17F2N3O2 — CID 55230418
N-[2-(difluoromethyl)-4-nitrophenyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 55230418) has the molecular formula C12H17F2N3O2 and a molecular weight of 273.28 g/mol. Its IUPAC name is N-[2-(difluoromethyl)-4-nitrophenyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[2-(difluoromethyl)-4-nitrophenyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 55230418 |
| Molecular Formula | C12H17F2N3O2 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-[2-(difluoromethyl)-4-nitrophenyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1ccc([N+](=O)[O-])cc1C(F)F |
| InChI | InChI=1S/C12H17F2N3O2/c1-16(2)7-3-6-15-11-5-4-9(17(18)19)8-10(11)12(13)14/h4-5,8,12,15H,3,6-7H2,1-2H3 |
| InChIKey | BGBQUCODAPIKPT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|