C10H13F2N3O4S — CID 106337659
2-[2-(difluoromethyl)-4-nitroanilino]-N-methylethanesulfonamide (PubChem CID 106337659) has the molecular formula C10H13F2N3O4S and a molecular weight of 309.29 g/mol. Its IUPAC name is 2-[2-(difluoromethyl)-4-nitroanilino]-N-methylethanesulfonamide.
| Compound Name | 2-[2-(difluoromethyl)-4-nitroanilino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 106337659 |
| Molecular Formula | C10H13F2N3O4S |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-[2-(difluoromethyl)-4-nitroanilino]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNc1ccc([N+](=O)[O-])cc1C(F)F |
| InChI | InChI=1S/C10H13F2N3O4S/c1-13-20(18,19)5-4-14-9-3-2-7(15(16)17)6-8(9)10(11)12/h2-3,6,10,13-14H,4-5H2,1H3 |
| InChIKey | PXOKRPQXZZKYFT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|