C14H21F2N3O2 — CID 63749883
N-[2-(difluoromethyl)-4-nitrophenyl]-N',N',2,2-tetramethylpropane-1,3-diamine (PubChem CID 63749883) has the molecular formula C14H21F2N3O2 and a molecular weight of 301.34 g/mol. Its IUPAC name is N-[2-(difluoromethyl)-4-nitrophenyl]-N',N',2,2-tetramethylpropane-1,3-diamine.
| Compound Name | N-[2-(difluoromethyl)-4-nitrophenyl]-N',N',2,2-tetramethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 63749883 |
| Molecular Formula | C14H21F2N3O2 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | N-[2-(difluoromethyl)-4-nitrophenyl]-N',N',2,2-tetramethylpropane-1,3-diamine |
| SMILES | CN(C)CC(C)(C)CNc1ccc([N+](=O)[O-])cc1C(F)F |
| InChI | InChI=1S/C14H21F2N3O2/c1-14(2,9-18(3)4)8-17-12-6-5-10(19(20)21)7-11(12)13(15)16/h5-7,13,17H,8-9H2,1-4H3 |
| InChIKey | OTOASCWQPGACFQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|