C14H20F2N2O3 — CID 106144889
5-[2-(difluoromethyl)-4-nitroanilino]-4,4-dimethylpentan-1-ol (PubChem CID 106144889) has the molecular formula C14H20F2N2O3 and a molecular weight of 302.32 g/mol. Its IUPAC name is 5-[2-(difluoromethyl)-4-nitroanilino]-4,4-dimethylpentan-1-ol.
| Compound Name | 5-[2-(difluoromethyl)-4-nitroanilino]-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 106144889 |
| Molecular Formula | C14H20F2N2O3 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 5-[2-(difluoromethyl)-4-nitroanilino]-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(CCCO)CNc1ccc([N+](=O)[O-])cc1C(F)F |
| InChI | InChI=1S/C14H20F2N2O3/c1-14(2,6-3-7-19)9-17-12-5-4-10(18(20)21)8-11(12)13(15)16/h4-5,8,13,17,19H,3,6-7,9H2,1-2H3 |
| InChIKey | AHHKNQPXFBTEIS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|