C13H18F2N2O3 — CID 63735960
2-[2-(difluoromethyl)-4-nitroanilino]-4-methylpentan-1-ol (PubChem CID 63735960) has the molecular formula C13H18F2N2O3 and a molecular weight of 288.29 g/mol. Its IUPAC name is 2-[2-(difluoromethyl)-4-nitroanilino]-4-methylpentan-1-ol.
| Compound Name | 2-[2-(difluoromethyl)-4-nitroanilino]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 63735960 |
| Molecular Formula | C13H18F2N2O3 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2-[2-(difluoromethyl)-4-nitroanilino]-4-methylpentan-1-ol |
| SMILES | CC(C)CC(CO)Nc1ccc([N+](=O)[O-])cc1C(F)F |
| InChI | InChI=1S/C13H18F2N2O3/c1-8(2)5-9(7-18)16-12-4-3-10(17(19)20)6-11(12)13(14)15/h3-4,6,8-9,13,16,18H,5,7H2,1-2H3 |
| InChIKey | NPDGIYLMPBJBIK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|