C12H15F2N3O3 — CID 63735288
2-[2-(difluoromethyl)-4-nitroanilino]-N,N-dimethylpropanamide (PubChem CID 63735288) has the molecular formula C12H15F2N3O3 and a molecular weight of 287.27 g/mol. Its IUPAC name is 2-[2-(difluoromethyl)-4-nitroanilino]-N,N-dimethylpropanamide.
| Compound Name | 2-[2-(difluoromethyl)-4-nitroanilino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 63735288 |
| Molecular Formula | C12H15F2N3O3 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-[2-(difluoromethyl)-4-nitroanilino]-N,N-dimethylpropanamide |
| SMILES | CC(Nc1ccc([N+](=O)[O-])cc1C(F)F)C(=O)N(C)C |
| InChI | InChI=1S/C12H15F2N3O3/c1-7(12(18)16(2)3)15-10-5-4-8(17(19)20)6-9(10)11(13)14/h4-7,11,15H,1-3H3 |
| InChIKey | DIYVVLICELUSEC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|