C13H16F2N2O4 — CID 63749513
2-[2-(difluoromethyl)-4-nitroanilino]-4-methylpentanoic acid (PubChem CID 63749513) has the molecular formula C13H16F2N2O4 and a molecular weight of 302.28 g/mol. Its IUPAC name is 2-[2-(difluoromethyl)-4-nitroanilino]-4-methylpentanoic acid.
| Compound Name | 2-[2-(difluoromethyl)-4-nitroanilino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 63749513 |
| Molecular Formula | C13H16F2N2O4 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-[2-(difluoromethyl)-4-nitroanilino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(Nc1ccc([N+](=O)[O-])cc1C(F)F)C(=O)O |
| InChI | InChI=1S/C13H16F2N2O4/c1-7(2)5-11(13(18)19)16-10-4-3-8(17(20)21)6-9(10)12(14)15/h3-4,6-7,11-12,16H,5H2,1-2H3,(H,18,19) |
| InChIKey | SMWXJCNWYDKHDO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|